Prostaglandin G2
Prostaglandin G2 structure
|
Common Name | Prostaglandin G2 | ||
|---|---|---|---|---|
| CAS Number | 51982-36-6 | Molecular Weight | 368.465 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 517.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H32O6 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 175.5±23.6 °C | |
| Symbol |
GHS02, GHS07 |
Signal Word | Danger | |
| Name | prostaglandin G2 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 517.3±50.0 °C at 760 mmHg |
| Molecular Formula | C20H32O6 |
| Molecular Weight | 368.465 |
| Flash Point | 175.5±23.6 °C |
| Exact Mass | 368.219879 |
| PSA | 85.22000 |
| LogP | 4.39 |
| Vapour Pressure | 0.0±3.1 mmHg at 25°C |
| Index of Refraction | 1.545 |
| InChIKey | SGUKUZOVHSFKPH-YNNPMVKQSA-N |
| SMILES | CCCCCC(C=CC1C2CC(OO2)C1CC=CCCCC(=O)O)OO |
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H319-H336 |
| Supplemental HS | Repeated exposure may cause skin dryness or cracking. |
| Precautionary Statements | P210-P280-P304 + P340 + P312-P305 + P351 + P338-P337 + P313-P403 + P235 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | F: Flammable;Xi: Irritant; |
| Risk Phrases | R11 |
| Safety Phrases | 9-16-26 |
| RIDADR | UN 1090 3 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:551-11-1
CAS#:42935-17-1|
The cyclooxygenase reaction mechanism.
Biochemistry 41(52) , 15451-8, (2002)
|
|
|
Endotoxin priming of thromboxane-related vasoconstrictor responses in perfused rabbit lungs.
J. Appl. Physiol. 83(1) , 18-24, (1997) In prior studies of perfused lungs, endotoxin priming markedly enhanced thromboxane (Tx) generation and Tx-mediated vasoconstriction in response to secondarily applied bacterial exotoxins. The present... |
|
|
Comparison of peroxidase reaction mechanisms of prostaglandin H synthase-1 containing heme and mangano protoporphyrin IX.
J. Biol. Chem. 272(14) , 8885-94, (1997) Prostaglandin H synthase (PGHS) is a heme protein that catalyzes both the cyclooxygenase and peroxidase reactions needed to produce prostaglandins G2 and H2 from arachidonic acid. Replacement of the h... |
| Prostaglandin G2 |
| (5Z)-7-{(1R,4S,5R,6R)-6-[(1E,3S)-3-Hydroperoxy-1-octen-1-yl]-2,3-dioxabicyclo[2.2.1]hept-5-yl}-5-heptenoic acid |
| 5-Heptenoic acid, 7-[(1R,4S,5R,6R)-6-[(1E,3S)-3-hydroperoxy-1-octen-1-yl]-2,3-dioxabicyclo[2.2.1]hept-5-yl]-, (5Z)- |
| MFCD00036971 |