4,4'-Dinitro-2-biphenylamine structure
|
Common Name | 4,4'-Dinitro-2-biphenylamine | ||
|---|---|---|---|---|
| CAS Number | 51787-75-8 | Molecular Weight | 259.21800 | |
| Density | 1.434g/cm3 | Boiling Point | 472ºC at 760 mmHg | |
| Molecular Formula | C12H9N3O4 | Melting Point | 208-210ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 239.3ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5-nitro-2-(4-nitrophenyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.434g/cm3 |
|---|---|
| Boiling Point | 472ºC at 760 mmHg |
| Melting Point | 208-210ºC(lit.) |
| Molecular Formula | C12H9N3O4 |
| Molecular Weight | 259.21800 |
| Flash Point | 239.3ºC |
| Exact Mass | 259.05900 |
| PSA | 117.66000 |
| LogP | 4.37980 |
| Index of Refraction | 1.678 |
| InChIKey | FRZPYFUNNLIMEC-UHFFFAOYSA-N |
| SMILES | Nc1cc([N+](=O)[O-])ccc1-c1ccc([N+](=O)[O-])cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2921499090 |
|
~85%
4,4'-Dinitro-2-... CAS#:51787-75-8 |
| Literature: Bulletin des Societes Chimiques Belges, , vol. 99, # 3 p. 171 - 181 |
|
~%
4,4'-Dinitro-2-... CAS#:51787-75-8 |
| Literature: Russian Journal of Applied Chemistry, , vol. 84, # 9 p. 1541 - 1548 |
|
~%
4,4'-Dinitro-2-... CAS#:51787-75-8 |
| Literature: Russian Journal of Applied Chemistry, , vol. 84, # 9 p. 1541 - 1548 |
|
~%
4,4'-Dinitro-2-... CAS#:51787-75-8 |
| Literature: Gazzetta Chimica Italiana, , vol. 68, p. 77,84 |
|
~%
4,4'-Dinitro-2-... CAS#:51787-75-8 |
| Literature: Journal of the Chemical Society, , p. 703,706,707 |
|
~%
Detail
|
| Literature: Gazzetta Chimica Italiana, , vol. 64, p. 335,343, Gazzetta Chimica Italiana, , vol. 68, p. 77,86 |
| Precursor 6 | |
|---|---|
| DownStream 10 | |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 5-nitro-2-(4-nitrophenyl)phenylamine |
| 1-amino-3,8-dinitrobiphenyl |
| 4,4'-Dinitro-biphenyl-2-ylamin |
| 4,4'-Dinitro-2-biphenylamine |
| 2-amino-4,4'-dinitrobiphenyl |
| 4,4'-dinitrobiphenyl-2-amine |
| 4.4'-Dinitro-2-amino-biphenyl |
| amino-2 dinitro-4,4' biphenyle |
| 4,4'-Dinitrobiphenyl-2-ylamine |
| (1,1'-Biphenyl)-2-amine,4,4'-dinitro |
| MFCD00075056 |
| 4,4`-Dinitro-2-biphenylamine |
| 4,4'-Dinitro-(1,1'-biphenyl)-2-amine |
| EINECS 257-417-8 |