4,4'-Dinitro-2,2'-dicarbonylbiphenyl structure
|
Common Name | 4,4'-Dinitro-2,2'-dicarbonylbiphenyl | ||
|---|---|---|---|---|
| CAS Number | 62245-44-7 | Molecular Weight | 300.22300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H8N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,4'-dinitro-(1,1'-Biphenyl)-2,2'-dicarboxaldehyde |
|---|
| Molecular Formula | C14H8N2O6 |
|---|---|
| Molecular Weight | 300.22300 |
| Exact Mass | 300.03800 |
| PSA | 125.78000 |
| LogP | 3.84140 |
| InChIKey | ZNTIWIOQHHAIPY-UHFFFAOYSA-N |
| SMILES | O=Cc1cc([N+](=O)[O-])ccc1-c1ccc([N+](=O)[O-])cc1C=O |
| HS Code | 2913000090 |
|---|
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |