4,4'-DINITRO-2,2'-BIPYRIDINE N-OXIDE structure
|
Common Name | 4,4'-DINITRO-2,2'-BIPYRIDINE N-OXIDE | ||
|---|---|---|---|---|
| CAS Number | 84175-12-2 | Molecular Weight | 262.17800 | |
| Density | 1.63g/cm3 | Boiling Point | 586.8ºC at 760 mmHg | |
| Molecular Formula | C10H6N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 308.7ºC | |
| Name | 4-nitro-2-(4-nitropyridin-2-yl)-1-oxidopyridin-1-ium |
|---|---|
| Synonym | More Synonyms |
| Density | 1.63g/cm3 |
|---|---|
| Boiling Point | 586.8ºC at 760 mmHg |
| Molecular Formula | C10H6N4O5 |
| Molecular Weight | 262.17800 |
| Flash Point | 308.7ºC |
| Exact Mass | 262.03400 |
| PSA | 129.99000 |
| LogP | 3.03990 |
| Index of Refraction | 1.712 |
| InChIKey | URJOIZFTDVMRNQ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccnc(-c2cc([N+](=O)[O-])cc[n+]2[O-])c1 |
| HS Code | 2933399090 |
|---|
|
~41%
4,4'-DINITRO-2,... CAS#:84175-12-2 |
| Literature: Wenkert, David; Woodward, R. B. Journal of Organic Chemistry, 1983 , vol. 48, # 3 p. 283 - 289 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,4'-Dinitro-2,2'-bipyridyl N-Oxide |
| 4,4'-DINITRO-2,2'-BIPYRIDINE N-OXIDE |