5'-NITRO-2'-(4-NITROPHENYL)BENZANILIDE structure
|
Common Name | 5'-NITRO-2'-(4-NITROPHENYL)BENZANILIDE | ||
|---|---|---|---|---|
| CAS Number | 84682-33-7 | Molecular Weight | 363.32400 | |
| Density | 1.412g/cm3 | Boiling Point | 480.2ºC at 760 mmHg | |
| Molecular Formula | C19H13N3O5 | Melting Point | 239-242ºC(lit.) | |
| MSDS | N/A | Flash Point | 244.2ºC | |
| Name | N-[5-nitro-2-(4-nitrophenyl)phenyl]benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.412g/cm3 |
|---|---|
| Boiling Point | 480.2ºC at 760 mmHg |
| Melting Point | 239-242ºC(lit.) |
| Molecular Formula | C19H13N3O5 |
| Molecular Weight | 363.32400 |
| Flash Point | 244.2ºC |
| Exact Mass | 363.08600 |
| PSA | 120.74000 |
| LogP | 5.54170 |
| Index of Refraction | 1.691 |
| InChIKey | SXHSXUJZDOVNJP-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cc([N+](=O)[O-])ccc1-c1ccc([N+](=O)[O-])cc1)c1ccccc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-37/39 |
| HS Code | 2924299090 |
|
~93%
5'-NITRO-2'-(4-... CAS#:84682-33-7 |
| Literature: Lion, C.; Boukou-Poba, J. P.; Charvy, C. Bulletin des Societes Chimiques Belges, 1990 , vol. 99, # 3 p. 171 - 181 |
|
~%
5'-NITRO-2'-(4-... CAS#:84682-33-7 |
| Literature: Bulletin des Societes Chimiques Belges, , vol. 99, # 3 p. 171 - 181 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD00075062 |
| EINECS 283-596-7 |
| N-(4,4'-Dinitro-biphenyl-2-yl)-benzamid |
| 4.4'-Dinitro-2-benzamino-biphenyl |
| benzamido-2 dinitro-4,4' biphenyle |
| N-(4,4'-dinitro-biphenyl-2-yl)-benzamide |
| N-[4,4'-dinitro(1,1'-biphenyl)-2-yl]benzamide |