1,4-dichloro-2-(4-nitrophenoxy)benzene structure
|
Common Name | 1,4-dichloro-2-(4-nitrophenoxy)benzene | ||
|---|---|---|---|---|
| CAS Number | 39145-48-7 | Molecular Weight | 284.09500 | |
| Density | 1.451g/cm3 | Boiling Point | 359.2ºC at 760 mmHg | |
| Molecular Formula | C12H7Cl2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.1ºC | |
| Name | 1,4-dichloro-2-(4-nitrophenoxy)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.451g/cm3 |
|---|---|
| Boiling Point | 359.2ºC at 760 mmHg |
| Molecular Formula | C12H7Cl2NO3 |
| Molecular Weight | 284.09500 |
| Flash Point | 171.1ºC |
| Exact Mass | 282.98000 |
| PSA | 55.05000 |
| LogP | 5.21710 |
| Index of Refraction | 1.623 |
| InChIKey | UKGBFXVWMSJQQW-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Oc2cc(Cl)ccc2Cl)cc1 |
| HS Code | 2909309090 |
|---|
|
~88%
1,4-dichloro-2-... CAS#:39145-48-7 |
| Literature: Mishra, Amita; Batchu, Harikrishna; Srivastava, Kumkum; Singh, Pratiksha; Shukla, Pravin K.; Batra, Sanjay Bioorganic and Medicinal Chemistry Letters, 2014 , vol. 24, # 7 p. 1719 - 1723 |
|
~90%
1,4-dichloro-2-... CAS#:39145-48-7 |
| Literature: Hoechst Aktiengesellschaft Patent: US4056553 A1, 1977 ; |
|
~%
1,4-dichloro-2-... CAS#:39145-48-7 |
| Literature: Barry et al. Pr. Irish Acad., 1950 , vol. 53 B, p. 61,66, 82 |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-nitro-2',5'-dichlorodiphenyl ether |
| 2,5-dichlorophenyl 4-nitrophenyl ether |
| EINECS 254-317-6 |