2-Hydroxy Ibuprofen structure
|
Common Name | 2-Hydroxy Ibuprofen | ||
|---|---|---|---|---|
| CAS Number | 51146-55-5 | Molecular Weight | 222.28000 | |
| Density | 1.125 g/cm3 | Boiling Point | 369.4ºC at 760 mmHg | |
| Molecular Formula | C13H18O3 | Melting Point | 120-122ºC | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of 2-Hydroxy Ibuprofen2-Hydroxy Ibuprofen is a metabolite of Ibuprofen. Ibuprofen is an anti-inflammatory inhibitor targeting COX-1 and COX-2 with IC50s of 13 μM and 370 μM, respectively. |
| Name | rac 2-Hydroxy Ibuprofen |
|---|---|
| Synonym | More Synonyms |
| Description | 2-Hydroxy Ibuprofen is a metabolite of Ibuprofen. Ibuprofen is an anti-inflammatory inhibitor targeting COX-1 and COX-2 with IC50s of 13 μM and 370 μM, respectively. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.125 g/cm3 |
|---|---|
| Boiling Point | 369.4ºC at 760 mmHg |
| Melting Point | 120-122ºC |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28000 |
| Exact Mass | 222.12600 |
| PSA | 57.53000 |
| LogP | 2.18810 |
| Index of Refraction | 1.543 |
| InChIKey | UJHKVYPPCJBOSG-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)c1ccc(CC(C)(C)O)cc1 |
| Storage condition | -20°C Freezer |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2918199090 |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-[4-(2-Hydroxy-2-methylpropyl)phenyl]propionic acid |
| 2-[4-(2-hydroxy-2-methylpropyl)phenyl]propanoic acid |
| 2-Hydroxyibuprofen |
| Ibuprofen Impurity 19 |