2-[p-(1-Bromo-2-methylpropyl)phenyl]propionic Acid structure
|
Common Name | 2-[p-(1-Bromo-2-methylpropyl)phenyl]propionic Acid | ||
|---|---|---|---|---|
| CAS Number | 75625-98-8 | Molecular Weight | 285.17700 | |
| Density | 1.33g/cm3 | Boiling Point | 363.6ºC at 760 mmHg | |
| Molecular Formula | C13H17BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.7ºC | |
| Name | 2-[4-(1-bromo-2-methylpropyl)phenyl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 363.6ºC at 760 mmHg |
| Molecular Formula | C13H17BrO2 |
| Molecular Weight | 285.17700 |
| Flash Point | 173.7ºC |
| Exact Mass | 284.04100 |
| PSA | 37.30000 |
| LogP | 3.96670 |
| Index of Refraction | 1.552 |
| InChIKey | JMYFDQVXABRDFF-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)c1ccc(C(Br)C(C)C)cc1 |
|
~53%
2-[p-(1-Bromo-2... CAS#:75625-98-8 |
| Literature: Kurtz, Richard R.; Houser, David J. Journal of Organic Chemistry, 1981 , vol. 46, # 1 p. 202 - 203 |
| 2-<p-(1-bromo-2-methylpropyl)phenyl>propionic acid |
| 2-[4-(1-Bromo-2-methyl-propyl)-phenyl]-propionic Acid |