PEG2-bis(phosphonic acid diethyl ester)
Modify Date: 2025-09-02 18:29:40
PEG2-bis(phosphonic acid diethyl ester) structure
|
Common Name | PEG2-bis(phosphonic acid diethyl ester) | ||
|---|---|---|---|---|
| CAS Number | 500347-73-9 | Molecular Weight | 378.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H28O9P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PEG2-bis(phosphonic acid diethyl ester)PEG2-bis(phosphonic acid diethyl ester) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | PEG3-bis(phosphonic acid diethyl ester) |
|---|---|
| Synonym | More Synonyms |
| Description | PEG2-bis(phosphonic acid diethyl ester) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C12H28O9P2 |
|---|---|
| Molecular Weight | 378.29 |
| InChIKey | CJAGHBDQWWLWAX-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC)OCCOCCOP(=O)(OCC)OCC |
| MFCD26127817 |