CK2α-IN-1
Modify Date: 2025-08-26 10:45:19
CK2α-IN-1 structure
|
Common Name | CK2α-IN-1 | ||
|---|---|---|---|---|
| CAS Number | 443747-52-2 | Molecular Weight | 341.34 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 597.1±60.0 °C at 760 mmHg | |
| Molecular Formula | C16H11N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 314.9±32.9 °C | |
Use of CK2α-IN-1CK2α-IN-1 (compound 2) is a selective CK2α inhibitor (IC50=7.0 µM; Ki=1.6 µM) that exhibits a non-ATP-competitive mode of action. CK2α-IN-1 exhibits good potential for anticancer studies[1]. |
| Name | WAY-302713-A |
|---|---|
| Synonym | More Synonyms |
| Description | CK2α-IN-1 (compound 2) is a selective CK2α inhibitor (IC50=7.0 µM; Ki=1.6 µM) that exhibits a non-ATP-competitive mode of action. CK2α-IN-1 exhibits good potential for anticancer studies[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50:7.0 µM (CK2α)[1]. |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 597.1±60.0 °C at 760 mmHg |
| Molecular Formula | C16H11N3O4S |
| Molecular Weight | 341.34 |
| Flash Point | 314.9±32.9 °C |
| Exact Mass | 341.047028 |
| LogP | 3.64 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.722 |
| InChIKey | KYJUPOUIAXBNDS-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc(Nc2nc(-c3cccc([N+](=O)[O-])c3)cs2)c1 |
| Benzoic acid, 3-[[4-(3-nitrophenyl)-2-thiazolyl]amino]- |
| 3-{[4-(3-Nitrophenyl)-1,3-thiazol-2-yl]amino}benzoic acid |