7,8-Dihydroxyflavone structure
|
Common Name | 7,8-Dihydroxyflavone | ||
|---|---|---|---|---|
| CAS Number | 38183-03-8 | Molecular Weight | 254.24 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 494.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C15H10O4 | Melting Point | 243-246°C | |
| MSDS | Chinese USA | Flash Point | 193.5±22.2 °C | |
Use of 7,8-Dihydroxyflavone7,8-Dihydroxyflavone is a potent and selective TrkB agonist that mimics the physiological actions of Brain-derived neurotrophic factor (BDNF). Displays therapeutic efficacy toward various neurological diseases[1]. |
| Name | 7,8-dihydroxyflavone |
|---|---|
| Synonym | More Synonyms |
| Description | 7,8-Dihydroxyflavone is a potent and selective TrkB agonist that mimics the physiological actions of Brain-derived neurotrophic factor (BDNF). Displays therapeutic efficacy toward various neurological diseases[1]. |
|---|---|
| Related Catalog | |
| Target |
TrkB[1] |
| In Vitro | 7,8-Dihydroxyflavone (500 nM) protects the primary cortical neurons and locus coeruleus (LC) neurons from Aβ-induced toxicity and promotes dendritic growth and synaptogenesis[1]. |
| In Vivo | 7,8-Dihydroxyflavone (5 mg/kg/day) prevents synaptic loss and memory deficits in a mouse model of Alzheimer’s Disease[1]. Administration of 7,8- dihydroxyflavone to mice activates TrkB in the brain, inhibits kainic acid-induced toxicity, decreases infarct volumes in stroke in a TrkBdependent manner, and is neuroprotective in an animal model of Parkinson disease[2]. |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 494.4±45.0 °C at 760 mmHg |
| Melting Point | 243-246°C |
| Molecular Formula | C15H10O4 |
| Molecular Weight | 254.24 |
| Flash Point | 193.5±22.2 °C |
| Exact Mass | 254.057907 |
| PSA | 70.67000 |
| LogP | 2.51 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.699 |
| InChIKey | COCYGNDCWFKTMF-UHFFFAOYSA-N |
| SMILES | O=c1cc(-c2ccccc2)oc2c(O)c(O)ccc12 |
| Storage condition | Store at +4°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATAMUTATION DATA
|
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 7,8-dihydroxy-2-phenylchromen-4-one |
| 7,8-Dihydroxyflavone Hydrate |
| 7,8-Dihydroxy-2-phenyl-4H-chromen-4-one |
| EINECS 253-812-4 |
| 7,8-Dihydroxy-2-phenyl-4H-1-benzopyran-4-one |
| MFCD00006836 |
| 7,8-Dihydroxyflavone |
| 4H-1-Benzopyran-4-one, 7,8-dihydroxy-2-phenyl- |