Decamethoxine
Modify Date: 2025-09-11 09:13:25
Decamethoxine structure
|
Common Name | Decamethoxine | ||
|---|---|---|---|---|
| CAS Number | 38146-42-8 | Molecular Weight | 693.91 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C38H74Cl2N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of DecamethoxineDecamethoxine (Septefril) is a cationic gemini surfactant. Decamethoxine exhibits strong bactericidal and fungicidal effects. Decamethoxine modifies the permeability of the microbial cell membrane, resulting in the destruction and death of diverse microorganisms[1][2]. |
| Name | N,N'-Bis{2-[(2-isopropyl-5-methylcyclohexyl)oxy]-2-oxoethyl}-N,N, N',N'-tetramethyl-1,10-decanediaminium dichloride |
|---|---|
| Synonym | More Synonyms |
| Description | Decamethoxine (Septefril) is a cationic gemini surfactant. Decamethoxine exhibits strong bactericidal and fungicidal effects. Decamethoxine modifies the permeability of the microbial cell membrane, resulting in the destruction and death of diverse microorganisms[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Decamethoxine (Septefril) has a wide spectrum of antimicrobial action on Gram-positive bacteria (Staphylococcus, Streptococcus, Pneumococcus), Gram-negative bacteria (Pseudomonoas, Neisseria gonorrhoeae, Chlamydia trachomatis), protozoa, dermatophyte, yeast-like fungi of Candida genus, and viruses[1]. Decamethoxine at a concentration of 10 µg/ml drastically reduces the adhesion of coryneform bacteria, Salmonella, Staphylococcus, and Escherichia [2]. |
| References |
| Molecular Formula | C38H74Cl2N2O4 |
|---|---|
| Molecular Weight | 693.91 |
| Exact Mass | 692.50300 |
| PSA | 52.60000 |
| LogP | 2.27600 |
| InChIKey | LRQIWRXCHWNNEA-UHFFFAOYSA-L |
| SMILES | CC1CCC(C(C)C)C(OC(=O)C[N+](C)(C)CCCCCCCCCC[N+](C)(C)CC(=O)OC2CC(C)CCC2C(C)C)C1.[Cl-].[Cl-] |
| Hazard Codes | Xi |
|---|
| MFCD02654058 |