4-Chloro-2-nitrophenylacetic acid structure
|
Common Name | 4-Chloro-2-nitrophenylacetic acid | ||
|---|---|---|---|---|
| CAS Number | 37777-71-2 | Molecular Weight | 215.59100 | |
| Density | 1.532g/cm3 | Boiling Point | 361.2ºC at 760mmHg | |
| Molecular Formula | C8H6ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.2ºC | |
| Name | 2-(4-chloro-2-nitrophenyl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.532g/cm3 |
|---|---|
| Boiling Point | 361.2ºC at 760mmHg |
| Molecular Formula | C8H6ClNO4 |
| Molecular Weight | 215.59100 |
| Flash Point | 172.2ºC |
| Exact Mass | 214.99900 |
| PSA | 83.12000 |
| LogP | 2.39850 |
| Index of Refraction | 1.61 |
| InChIKey | FLZUSUKBKOZJLG-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1ccc(Cl)cc1[N+](=O)[O-] |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2916399090 |
| Precursor 8 | |
|---|---|
| DownStream 2 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-nitro-4-chlorophenylacetic acid |
| 2-Nitro-4-chlor-phenylessigsaeure |
| 4-chloro-2-nitro-benzeneacetic acid |
| 4-Chloro-2-nitrophenylacetic acid |