3-Chloro-2-nitrophenylacetic Acid structure
|
Common Name | 3-Chloro-2-nitrophenylacetic Acid | ||
|---|---|---|---|---|
| CAS Number | 23066-21-9 | Molecular Weight | 215.590 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 374.2±27.0 °C at 760 mmHg | |
| Molecular Formula | C8H6ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.1±23.7 °C | |
| Name | 2-(3-chloro-2-nitrophenyl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 374.2±27.0 °C at 760 mmHg |
| Molecular Formula | C8H6ClNO4 |
| Molecular Weight | 215.590 |
| Flash Point | 180.1±23.7 °C |
| Exact Mass | 214.998535 |
| PSA | 83.12000 |
| LogP | 1.62 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | BLJTYQBHLXPJPG-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1cccc(Cl)c1[N+](=O)[O-] |
| HS Code | 2916399090 |
|---|
|
~%
3-Chloro-2-nitr... CAS#:23066-21-9 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 17, # 3 p. 605 - 610 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| RW3050 |
| 3-Chloro-2-nitrophenylacetic Acid |
| (3-Chloro-2-nitrophenyl)acetic acid |
| 2-(3-Chloro-2-nitrophenyl)acetic acid |
| (2-Nitro-3-chlor-phenyl)-essigsaeure |
| Benzeneacetic acid, 3-chloro-2-nitro- |