(2,4-Dinitrophenyl)acetic acid structure
|
Common Name | (2,4-Dinitrophenyl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 643-43-6 | Molecular Weight | 226.143 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 430.2±30.0 °C at 760 mmHg | |
| Molecular Formula | C8H6N2O6 | Melting Point | 169-175 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 191.8±13.0 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,4-dinitrophenylacetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 430.2±30.0 °C at 760 mmHg |
| Melting Point | 169-175 °C(lit.) |
| Molecular Formula | C8H6N2O6 |
| Molecular Weight | 226.143 |
| Flash Point | 191.8±13.0 °C |
| Exact Mass | 226.022583 |
| PSA | 128.94000 |
| LogP | 0.90 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.637 |
| InChIKey | KCNISYPADDTFDO-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | O:Oxidizing; |
| Risk Phrases | R8 |
| Safety Phrases | S26-S36 |
| RIDADR | 1479 |
| WGK Germany | 3 |
| RTECS | AH2230000 |
| Packaging Group | III |
| Hazard Class | 5.1 |
| HS Code | 2916399090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
A reinvestigation of the pre-steady-state ATPase activity of the nitrogenase from Azotobacter vinelandii.
Eur. J. Biochem. 208(2) , 289-94, (1992) The pre-steady-state ATPase activity of nitrogenase has been reinvestigated. The exceptionally high burst in the hydrolysis of MgATP by the nitrogenase from Azotobacter vinelandii communicated by Cord... |
|
|
Synthesis of a parabactin photoaffinity label. Bergeron RJ, et al.
J. Org. Chem. 52(1) , 144-49, (1987)
|
|
|
The coupling of diazonium salts with aliphatic carbon atoms. Parmerter SM.
Org. React. , (1959)
|
| 2-(2,4-dinitrophenyl)acetic acid |
| MFCD00007227 |
| EINECS 211-398-2 |
| Benzeneacetic acid, 2,4-dinitro- |
| (2,4-Dinitrophenyl)acetic acid |