Ste11 MAPKKK Activation Inhibitor structure
|
Common Name | Ste11 MAPKKK Activation Inhibitor | ||
|---|---|---|---|---|
| CAS Number | 331662-51-2 | Molecular Weight | 350.2 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 463.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C16H¹³Cl2N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.4±28.7 °C | |
| Name | Ste11 MAPKKK Activation Inhibitor |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 463.9±45.0 °C at 760 mmHg |
| Molecular Formula | C16H¹³Cl2N3O2 |
| Molecular Weight | 350.2 |
| Flash Point | 234.4±28.7 °C |
| Exact Mass | 349.038483 |
| LogP | 4.77 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.672 |
| InChIKey | PKEYRKYHSXFGBA-UHFFFAOYSA-N |
| SMILES | COc1cc2ncnc(Nc3ccc(Cl)cc3Cl)c2cc1OC |
| Water Solubility | DMSO and ethanol |
| N-(2,4-Dichlorophenyl)-6,7-dimethoxy-4-quinazolinamine |
| N-(2,4-dichlorophenyl)-6,7-dimethoxyquinazolin-4-amine |
| MFCD01815305 |
| 4-Quinazolinamine, N-(2,4-dichlorophenyl)-6,7-dimethoxy- |