WAY-304671
Modify Date: 2025-09-18 19:33:37
WAY-304671 structure
|
Common Name | WAY-304671 | ||
|---|---|---|---|---|
| CAS Number | 330837-95-1 | Molecular Weight | 344.83846 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H9ClN2OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of WAY-304671WAY-304671 is an active molecule and a potential ubiquitin ligase inhibitor. |
| Name | WAY-304671 |
|---|---|
| Synonym | More Synonyms |
| Description | WAY-304671 is an active molecule and a potential ubiquitin ligase inhibitor. |
|---|---|
| Related Catalog | |
| Target |
Ubiquitin Ligase |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Molecular Formula | C16H9ClN2OS2 |
| Molecular Weight | 344.83846 |
| Exact Mass | 343.984467 |
| LogP | 5.86 |
| Index of Refraction | 1.823 |
| InChIKey | YOYPBQIYPQJMRP-UHFFFAOYSA-N |
| SMILES | O=C(Nc1nc2ccccc2s1)c1sc2ccccc2c1Cl |
| N-(1,3-Benzothiazol-2-yl)-3-chloro-1-benzothiophene-2-carboxamide |
| Benzo[b]thiophene-2-carboxamide, N-2-benzothiazolyl-3-chloro- |
| MFCD01449807 |