4-Nitroguaiacol structure
|
Common Name | 4-Nitroguaiacol | ||
|---|---|---|---|---|
| CAS Number | 3251-56-7 | Molecular Weight | 169.135 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 335.2±27.0 °C at 760 mmHg | |
| Molecular Formula | C7H7NO4 | Melting Point | 102-104 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 156.5±23.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-Methoxy-4-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 335.2±27.0 °C at 760 mmHg |
| Melting Point | 102-104 °C(lit.) |
| Molecular Formula | C7H7NO4 |
| Molecular Weight | 169.135 |
| Flash Point | 156.5±23.7 °C |
| Exact Mass | 169.037506 |
| PSA | 75.28000 |
| LogP | 1.58 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | IZLVFLOBTPURLP-UHFFFAOYSA-N |
| SMILES | COc1cc([N+](=O)[O-])ccc1O |
| Storage condition | Refrigerator |
| Water Solubility | insoluble |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | SL7800000 |
| HS Code | 2909500000 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2909500000 |
|---|---|
| Summary | 2909500000 ether-phenols, ether-alcohol-phenols and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Phase II metabolism in human skin: skin explants show full coverage for glucuronidation, sulfation, N-acetylation, catechol methylation, and glutathione conjugation.
Drug Metab. Dispos. 43(1) , 126-39, (2014) Although skin is the largest organ of the human body, cutaneous drug metabolism is often overlooked, and existing experimental models are insufficiently validated. This proof-of-concept study investig... |
| 4-Hydroxy-3-methoxynitrobenzene |
| EINECS 221-839-0 |
| 2-Methoxy-4-nitrophenol |
| MFCD00012143 |
| Phenol,o-methoxy-p-nitro |
| Mononitro guaiacol |
| 3-Nitro-6-hydroxyanisole |
| 4-nitro-2-methoxyphenol |
| Phenol,2-methoxy-4-nitro |
| o-Methoxy-p-nitrophenol |
| 2-Methoxy-4-nitro-phenol |
| 4-Nitroguaiacol |
| Guaiacol,4-nitro |
| 2-Hydroxy-5-nitroanisole |
| Phenol, 2-methoxy-4-nitro- |