Communic acid structure
|
Common Name | Communic acid | ||
|---|---|---|---|---|
| CAS Number | 2761-77-5 | Molecular Weight | 302.451 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 414.0±34.0 °C at 760 mmHg | |
| Molecular Formula | C20H30O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.8±20.3 °C | |
Use of Communic acidCommunic acid ((+)-Communic acid) is a natural compound isolated from the branches of Platycladus orientalis. Communic acid displays minimum inhibitory concentration of 31 μM and IC50 of 15 μM against M. tuberculosis H37Ra.Communic acid exhibits protective effects against UVB-induced skin aging[1][2][3]. |
| Name | Communic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Communic acid ((+)-Communic acid) is a natural compound isolated from the branches of Platycladus orientalis. Communic acid displays minimum inhibitory concentration of 31 μM and IC50 of 15 μM against M. tuberculosis H37Ra.Communic acid exhibits protective effects against UVB-induced skin aging[1][2][3]. |
|---|---|
| Related Catalog | |
| Target |
15 μM (M. tuberculosis H37Ra) [2] |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 414.0±34.0 °C at 760 mmHg |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.451 |
| Flash Point | 199.8±20.3 °C |
| Exact Mass | 302.224579 |
| PSA | 37.30000 |
| LogP | 6.69 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Index of Refraction | 1.520 |
| InChIKey | YGBZFOQXPOGACY-TZJYRCSTSA-N |
| SMILES | C=CC(C)=CCC1C(=C)CCC2C(C)(C(=O)O)CCCC12C |
| Hazard Codes | Xi |
|---|
| (1S,4aR,5S,8aR)-1,4a-Dimethyl-6-methylene-5-[(2E)-3-methyl-2,4-pentadien-1-yl]decahydro-1-naphthalenecarboxylic acid |
| 1-Naphthalenecarboxylic acid, decahydro-1,4a-dimethyl-6-methylene-5-[(2E)-3-methyl-2,4-pentadien-1-yl]-, (1S,4aR,5S,8aR)- |