AKT-IN-7
Modify Date: 2025-08-25 18:11:29
AKT-IN-7 structure
|
Common Name | AKT-IN-7 | ||
|---|---|---|---|---|
| CAS Number | 2654025-97-3 | Molecular Weight | 454.95 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H27ClN6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of AKT-IN-7AKT-IN-7 (compound 1-P1) is a potent AKT inhibitor. AKT-IN-7 has the potential for cancer research[1]. |
| Name | AKT-IN-7 |
|---|
| Description | AKT-IN-7 (compound 1-P1) is a potent AKT inhibitor. AKT-IN-7 has the potential for cancer research[1]. |
|---|---|
| Related Catalog | |
| Target |
Akt |
| References |
| Molecular Formula | C23H27ClN6O2 |
|---|---|
| Molecular Weight | 454.95 |
| InChIKey | TUBYVHRFVFOCTE-QZTJIDSGSA-N |
| SMILES | CC(C)NCC(C(=O)N1CCN2c3ncnc4[nH]cc(c34)OCC2C1)c1ccc(Cl)cc1 |