Pan-Trk-IN-2 structure
|
Common Name | Pan-Trk-IN-2 | ||
|---|---|---|---|---|
| CAS Number | 2583778-77-0 | Molecular Weight | 506.86 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H18ClF3N6O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Pan-Trk-IN-2Compound cpd-1 is a small molecule Trks inhibitor with good antitumor activity[1]. |
| Name | Pan-Trk-IN-2 |
|---|
| Description | Compound cpd-1 is a small molecule Trks inhibitor with good antitumor activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C22H18ClF3N6O3 |
|---|---|
| Molecular Weight | 506.86 |
| InChIKey | KQZFHDUZMBMCMO-UHFFFAOYSA-N |
| SMILES | CC1(C)Oc2c(ncnc2Nc2ccc(NC(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)cc2)NC1=O |