Biotin-PEG3-acid structure
|
Common Name | Biotin-PEG3-acid | ||
|---|---|---|---|---|
| CAS Number | 252881-76-8 | Molecular Weight | 447.546 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 770.7±60.0 °C at 760 mmHg | |
| Molecular Formula | C19H33N3O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 419.9±32.9 °C | |
Use of Biotin-PEG3-acidBiotin-PEG3-acid is a biotin-labeled, PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 14-Oxo-18-[(3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl]-4,7,10-trioxa-13-azaoctadecan-1-oic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Biotin-PEG3-acid is a biotin-labeled, PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 770.7±60.0 °C at 760 mmHg |
| Molecular Formula | C19H33N3O7S |
| Molecular Weight | 447.546 |
| Flash Point | 419.9±32.9 °C |
| Exact Mass | 447.203918 |
| LogP | -1.40 |
| Vapour Pressure | 0.0±5.7 mmHg at 25°C |
| Index of Refraction | 1.520 |
| InChIKey | HRGPPBXEZFBGDJ-MPGHIAIKSA-N |
| SMILES | O=C(O)CCOCCOCCOCCNC(=O)CCCCC1SCC2NC(=O)NC21 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|
| 4,7,10-Trioxa-13-azaoctadecan-1-oic acid, 18-[(3aS,4S,6aR)-hexahydro-2-oxo-1H-thieno[3,4-d]imidazol-4-yl]-14-oxo- |
| MFCD22574817 |
| 14-Oxo-18-[(3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl]-4,7,10-trioxa-13-azaoctadecan-1-oic acid |