Cl-PEG6-acid structure
|
Common Name | Cl-PEG6-acid | ||
|---|---|---|---|---|
| CAS Number | 2365309-92-6 | Molecular Weight | 358.81 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H27ClO8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Cl-PEG6-acidCl-PEG6-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Cl-PEG6-acid |
|---|
| Description | Cl-PEG6-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C14H27ClO8 |
|---|---|
| Molecular Weight | 358.81 |
| InChIKey | CFSDNFNBCGLKFQ-UHFFFAOYSA-N |
| SMILES | O=C(O)COCCOCCOCCOCCOCCOCCCl |