Hydroxy-PEG6-acid structure
|
Common Name | Hydroxy-PEG6-acid | ||
|---|---|---|---|---|
| CAS Number | 1347750-85-9 | Molecular Weight | 354.393 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 489.6±45.0 °C at 760 mmHg | |
| Molecular Formula | C15H30O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.9±22.2 °C | |
Use of Hydroxy-PEG6-acidHydroxy-PEG6-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Hydroxy-PEG6-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 489.6±45.0 °C at 760 mmHg |
| Molecular Formula | C15H30O9 |
| Molecular Weight | 354.393 |
| Flash Point | 168.9±22.2 °C |
| Exact Mass | 354.188995 |
| LogP | -2.78 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
| Index of Refraction | 1.468 |
| InChIKey | LGLHJMFNIHYJBM-UHFFFAOYSA-N |
| SMILES | O=C(O)CCOCCOCCOCCOCCOCCOCCO |
| 3,6,9,12,15,18-Hexaoxaheneicosan-21-oic acid, 1-hydroxy- |
| 1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid |