MYC-IN-2
Modify Date: 2025-09-02 18:34:18
MYC-IN-2 structure
|
Common Name | MYC-IN-2 | ||
|---|---|---|---|---|
| CAS Number | 2244979-61-9 | Molecular Weight | 423.49 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H17N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MYC-IN-2MYC-IN-2 is a MYC protein-protein inhibitor. MYC-IN-2 can be used for the research of cancer[1]. |
| Name | MYC-IN-2 |
|---|
| Description | MYC-IN-2 is a MYC protein-protein inhibitor. MYC-IN-2 can be used for the research of cancer[1]. |
|---|---|
| Related Catalog | |
| Target |
MYC protein-protein[1] |
| In Vitro | MYC-IN-2 is a MYC protein-protein inhibitor[1]. |
| References |
| Molecular Formula | C25H17N3O2S |
|---|---|
| Molecular Weight | 423.49 |
| InChIKey | HMVOKQDXOYWIBC-UHFFFAOYSA-N |
| SMILES | NC(=O)c1ccc(-c2cc(-c3ccc(-c4nccs4)cc3)nc(-c3ccco3)c2)cc1 |