Ac-Ile-Glu-Pro-Asp-pNA structure
|
Common Name | Ac-Ile-Glu-Pro-Asp-pNA | ||
|---|---|---|---|---|
| CAS Number | 216757-29-8 | Molecular Weight | 634.635 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 1096.9±65.0 °C at 760 mmHg | |
| Molecular Formula | C28H38N6O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 617.2±34.3 °C | |
Use of Ac-Ile-Glu-Pro-Asp-pNAN-Acetyl-Ile-Glu-Pro-Asp-p-nitroanilide (Ac-IEPD-pNA) is a granzyme B substrate that allows accurate measurement of granzyme B activity[1]. |
| Name | (4S)-4-[[(2S,3S)-2-acetamido-3-methylpentanoyl]amino]-5-[(2S)-2-[[(2S)-3-carboxy-1-(4-nitroanilino)-1-oxopropan-2-yl]carbamoyl]pyrrolidin-1-yl]-5-oxopentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | N-Acetyl-Ile-Glu-Pro-Asp-p-nitroanilide (Ac-IEPD-pNA) is a granzyme B substrate that allows accurate measurement of granzyme B activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 1096.9±65.0 °C at 760 mmHg |
| Molecular Formula | C28H38N6O11 |
| Molecular Weight | 634.635 |
| Flash Point | 617.2±34.3 °C |
| Exact Mass | 634.259827 |
| PSA | 257.13000 |
| LogP | 2.01 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.592 |
| InChIKey | YXEIIOVAGGAMCZ-NYMCBPKFSA-N |
| SMILES | CCC(C)C(NC(C)=O)C(=O)NC(CCC(=O)O)C(=O)N1CCCC1C(=O)NC(CC(=O)O)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| Storage condition | -20°C |
| Hazard Codes | Xi |
|---|
| L-α-Asparagine, N-acetyl-L-isoleucyl-L-α-glutamyl-L-prolyl-N-(4-nitrophenyl)- |
| N-Acetyl-L-isoleucyl-L-α-glutamyl-L-prolyl-N-(4-nitrophenyl)-L-α-asparagine |