Z-Ile-Glu-Pro-Phe-Ome structure
|
Common Name | Z-Ile-Glu-Pro-Phe-Ome | ||
|---|---|---|---|---|
| CAS Number | 252557-97-4 | Molecular Weight | 652.735 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 928.4±65.0 °C at 760 mmHg | |
| Molecular Formula | C34H44N4O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 515.3±34.3 °C | |
Use of Z-Ile-Glu-Pro-Phe-OmeCH 5450 (Z-Ile-Glu-Pro-Phe-Ome) is a human chymase inhibitor. |
| Name | Z-Ile-Glu-Pro-Phe-Ome |
|---|---|
| Synonym | More Synonyms |
| Description | CH 5450 (Z-Ile-Glu-Pro-Phe-Ome) is a human chymase inhibitor. |
|---|---|
| Related Catalog | |
| Target |
Chymase |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 928.4±65.0 °C at 760 mmHg |
| Molecular Formula | C34H44N4O9 |
| Molecular Weight | 652.735 |
| Flash Point | 515.3±34.3 °C |
| Exact Mass | 652.310852 |
| LogP | 4.22 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.566 |
| InChIKey | NQFWNRFKRYMGAI-OXHJWIHTSA-N |
| SMILES | CCC(C)C(NC(=O)OCc1ccccc1)C(=O)NC(CCC(=O)O)C(=O)N1CCCC1C(=O)NC(Cc1ccccc1)C(=O)OC |
| Storage condition | -20°C |
| L-Phenylalanine, N-[(phenylmethoxy)carbonyl]-L-isoleucyl-L-α-glutamyl-L-prolyl-, methyl ester |
| Methyl N-[(benzyloxy)carbonyl]-L-isoleucyl-L-α-glutamyl-L-prolyl-L-phenylalaninate |