N-Boc-PEG9-alcohol
Modify Date: 2025-08-25 09:38:40
N-Boc-PEG9-alcohol structure
|
Common Name | N-Boc-PEG9-alcohol | ||
|---|---|---|---|---|
| CAS Number | 2112731-44-7 | Molecular Weight | 513.619 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 585.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C23H47NO11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 307.6±30.1 °C | |
Use of N-Boc-PEG9-alcoholN-Boc-PEG9-alcohol is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | N-Boc-PEG9-alcohol |
|---|---|
| Synonym | More Synonyms |
| Description | N-Boc-PEG9-alcohol is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker. |
| References |
[1]. Nello Mainolfi, wt al. Irak degraders and uses thereof. US20190192668A1. |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 585.1±50.0 °C at 760 mmHg |
| Molecular Formula | C23H47NO11 |
| Molecular Weight | 513.619 |
| Flash Point | 307.6±30.1 °C |
| Exact Mass | 513.314941 |
| LogP | -2.10 |
| Vapour Pressure | 0.0±3.7 mmHg at 25°C |
| Index of Refraction | 1.464 |
| InChIKey | RRJGWZKZLBILQF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCO |
| Hazard Codes | Xi |
|---|
| 2-Methyl-2-propanyl (26-hydroxy-3,6,9,12,15,18,21,24-octaoxahexacos-1-yl)carbamate |
| MFCD30723250 |
| Carbamic acid, N-(26-hydroxy-3,6,9,12,15,18,21,24-octaoxahexacos-1-yl)-, 1,1-dimethylethyl ester |