Cbz-PEG2-bromide
Modify Date: 2025-08-27 13:34:33
Cbz-PEG2-bromide structure
|
Common Name | Cbz-PEG2-bromide | ||
|---|---|---|---|---|
| CAS Number | 2100283-00-7 | Molecular Weight | 346.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20BrNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Cbz-PEG2-bromideCbz-PEG2-bromide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Cbz-PEG2-bromide |
|---|
| Description | Cbz-PEG2-bromide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C14H20BrNO4 |
|---|---|
| Molecular Weight | 346.22 |
| InChIKey | GRGPUJRSMCXZNT-UHFFFAOYSA-N |
| SMILES | O=C(NCCOCCOCCBr)OCc1ccccc1 |