LSD1-IN-7 Methylbenzenesulfonate structure
|
Common Name | LSD1-IN-7 Methylbenzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 2097523-57-2 | Molecular Weight | 623.67 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H31F2N5O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of LSD1-IN-7 MethylbenzenesulfonateLSD1-IN-7 Methylbenzenesulfonate is an orally bioavailable inhibitor of lysine specific demethylase-1 (LSD1) with anticancer activity extracted from patent WO2017079670A1, compound 4-[2-(4-amino-piperidin-1-yl)-5-(3-fluoro-4-methoxy-phenyl)-1-methyl-6-oxo-1,6-dihydro-pyrimidin-4-yl]-2-fluorobenzonitrile[1]. |
| Name | LSD1-IN-7 Methylbenzenesulfonate |
|---|
| Description | LSD1-IN-7 Methylbenzenesulfonate is an orally bioavailable inhibitor of lysine specific demethylase-1 (LSD1) with anticancer activity extracted from patent WO2017079670A1, compound 4-[2-(4-amino-piperidin-1-yl)-5-(3-fluoro-4-methoxy-phenyl)-1-methyl-6-oxo-1,6-dihydro-pyrimidin-4-yl]-2-fluorobenzonitrile[1]. |
|---|---|
| Related Catalog | |
| Target |
Lysine specific demethylase-1 (LSD1)[1] |
| References |
| Molecular Formula | C31H31F2N5O5S |
|---|---|
| Molecular Weight | 623.67 |
| InChIKey | OZZFOHIBJFKYLY-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2c(-c3ccc(C#N)c(F)c3)nc(N3CCC(N)CC3)n(C)c2=O)cc1F.Cc1ccc(S(=O)(=O)O)cc1 |