Boc-NH-PEG7-acid structure
|
Common Name | Boc-NH-PEG7-acid | ||
|---|---|---|---|---|
| CAS Number | 2055044-68-1 | Molecular Weight | 497.577 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 598.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C22H43NO11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 315.7±30.1 °C | |
Use of Boc-NH-PEG7-acidBoc-NH-PEG7-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Boc-NH-PEG7-CH2CH2COOH |
|---|---|
| Synonym | More Synonyms |
| Description | Boc-NH-PEG7-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 598.4±50.0 °C at 760 mmHg |
| Molecular Formula | C22H43NO11 |
| Molecular Weight | 497.577 |
| Flash Point | 315.7±30.1 °C |
| Exact Mass | 497.283600 |
| LogP | -1.22 |
| Vapour Pressure | 0.0±3.7 mmHg at 25°C |
| Index of Refraction | 1.468 |
| InChIKey | NRLJITQFPLHTDR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
| 2,2-Dimethyl-4-oxo-3,8,11,14,17,20,23,26-octaoxa-5-azanonacosan-29-oic acid |
| MFCD29052162 |
| 3,8,11,14,17,20,23,26-Octaoxa-5-azanonacosan-29-oic acid, 2,2-dimethyl-4-oxo- |