13-Acetylpodocarpa-8,11,13-trien-15-oic acid structure
|
Common Name | 13-Acetylpodocarpa-8,11,13-trien-15-oic acid | ||
|---|---|---|---|---|
| CAS Number | 200813-31-6 | Molecular Weight | 300.39 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 470.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C19H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.4±25.2 °C | |
Use of 13-Acetylpodocarpa-8,11,13-trien-15-oic acid16-Nor-15-oxodehydroabietic acid (compound 32) is a compound isolated from the root bark of Pinus massoniana[1]. |
| Name | 16-Nor-15-oxodehydroabietic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 16-Nor-15-oxodehydroabietic acid (compound 32) is a compound isolated from the root bark of Pinus massoniana[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 470.4±45.0 °C at 760 mmHg |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.39 |
| Flash Point | 252.4±25.2 °C |
| Exact Mass | 300.172546 |
| PSA | 54.37000 |
| LogP | 4.45 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.553 |
| InChIKey | VUSNLFYUMKLEAV-QXAKKESOSA-N |
| SMILES | CC(=O)c1ccc2c(c1)CCC1C(C)(C(=O)O)CCCC21C |
| Hazard Codes | Xi |
|---|
| 1-Phenanthrenecarboxylic acid, 7-acetyl-1,2,3,4,4a,9,10,10a-octahydro-1,4a-dimethyl-, (1R,4aS,10aR)- |
| 13-Acetylpodocarpa-8,11,13-trien-15-oic acid |