12-Hydroxyabieta-8,11,13-trien-20-oic acid
Modify Date: 2025-09-11 04:45:12
12-Hydroxyabieta-8,11,13-trien-20-oic acid structure
|
Common Name | 12-Hydroxyabieta-8,11,13-trien-20-oic acid | ||
|---|---|---|---|---|
| CAS Number | 67494-15-9 | Molecular Weight | 316.43 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 470.0±45.0 °C at 760 mmHg | |
| Molecular Formula | C20H28O3 | Melting Point | 197 °C | |
| MSDS | N/A | Flash Point | 252.2±25.2 °C | |
Use of 12-Hydroxyabieta-8,11,13-trien-20-oic acidPisiferic acid is an antibacterial agent with inhibitory activity against Gram-negative/positive bacteria such as P. vulgaris, S. aureus and B. subtilis. Pisiferic acid can be used to study bacterial infections[1]. |
| Name | (+)-pisiferic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Pisiferic acid is an antibacterial agent with inhibitory activity against Gram-negative/positive bacteria such as P. vulgaris, S. aureus and B. subtilis. Pisiferic acid can be used to study bacterial infections[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 470.0±45.0 °C at 760 mmHg |
| Melting Point | 197 °C |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.43 |
| Flash Point | 252.2±25.2 °C |
| Exact Mass | 316.203857 |
| PSA | 57.53000 |
| LogP | 5.53 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.558 |
| InChIKey | ATHWSPHADLLZSS-PXNSSMCTSA-N |
| SMILES | CC(C)c1cc2c(cc1O)C1(C(=O)O)CCCC(C)(C)C1CC2 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:3650-09-7| 4a(2H)-Phenanthrenecarboxylic acid, 1,3,4,9,10,10a-hexahydro-6-hydroxy-1,1-dimethyl-7-(1-methylethyl)-, (4aR,10aS)- |
| Pisiferic acid |
| 4a(2H)-Phenanthrenecarboxylic acid,1,3,4,9,10,10a-tetrahydro-6-hydroxy-1,1-dimethyl-7-(1-methylethyl)-,(4ar-trans) |
| 12-Hydroxyabieta-8,11,13-trien-20-oic acid |
| (4aR,10aS)-6-hydroxy-1,1-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-4a-carboxylic acid |