O-Methylpodocarpic acid
Modify Date: 2025-08-26 18:54:07
O-Methylpodocarpic acid structure
|
Common Name | O-Methylpodocarpic acid | ||
|---|---|---|---|---|
| CAS Number | 10037-26-0 | Molecular Weight | 288.381 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 431.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C18H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.0±22.2 °C | |
Use of O-Methylpodocarpic acidO-methylpodocarpic acid, an essential oil from tea tree oil, has in ro cytotoxic effects on human epithelial and tibroblast cells[1]. |
| Name | 6-methoxy-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | O-methylpodocarpic acid, an essential oil from tea tree oil, has in ro cytotoxic effects on human epithelial and tibroblast cells[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 431.8±45.0 °C at 760 mmHg |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.381 |
| Flash Point | 153.0±22.2 °C |
| Exact Mass | 288.172546 |
| PSA | 46.53000 |
| LogP | 4.92 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | WEGOBZDECLEAOK-NXHRZFHOSA-N |
| SMILES | COc1ccc2c(c1)C1(C)CCCC(C)(C(=O)O)C1CC2 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:5947-49-9
CAS#:23189-63-1| 12-methoxy-podocarpa-8,11,13-trien-16-oic acid |
| 12-Methoxypodocarpa-8,11,13-trien-15-oic acid |
| 12-methoxypodocarpa-8,11,13-trien-19-oic acid |
| O-methylpodocarpic acid |
| 12-O-methylpodocarpic acid |
| Diethylaminoethyl O-methyl-podocarpate |
| 12-methoxypodocarpa-8,11,13-triene-19-carboxylic acid |
| 1-Phenanthrenecarboxylic acid, 1,2,3,4,4a,9,10,10a-octahydro-6-methoxy-1,4a-dimethyl- |