Eicosapentaenoyl Serotonin
Modify Date: 2025-10-05 20:55:47
Eicosapentaenoyl Serotonin structure
|
Common Name | Eicosapentaenoyl Serotonin | ||
|---|---|---|---|---|
| CAS Number | 199875-71-3 | Molecular Weight | 460.651 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 681.5±55.0 °C at 760 mmHg | |
| Molecular Formula | C30H40N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 366.0±31.5 °C | |
Use of Eicosapentaenoyl SerotoninEicosapentaenoyl Serotonin is a dual fatty acid amide hydrolase (FAAH) and TRPV1 antagonist. |
| Name | N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]icosa-5,8,11,14,17-pentaenamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 681.5±55.0 °C at 760 mmHg |
| Molecular Formula | C30H40N2O2 |
| Molecular Weight | 460.651 |
| Flash Point | 366.0±31.5 °C |
| Exact Mass | 460.308990 |
| PSA | 65.12000 |
| LogP | 6.48 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | RYPAMQYLBIIZHL-JLNKQSITSA-N |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)NCCc1c[nH]c2ccc(O)cc12 |
| 5,8,11,14,17-Eicosapentaenamide, N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]-, (5Z,8Z,11Z,14Z,17Z)- |
| (5Z,8Z,11Z,14Z,17Z)-N-[2-(5-Hydroxy-1H-indol-3-yl)ethyl]-5,8,11,14,17-icosapentaenamide |
| Eicosapentaenoyl Serotonin |