Eicosapentaenoyl Chloride structure
|
Common Name | Eicosapentaenoyl Chloride | ||
|---|---|---|---|---|
| CAS Number | 98770-65-1 | Molecular Weight | 320.897 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 409.9±34.0 °C at 760 mmHg | |
| Molecular Formula | C20H29ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.5±18.8 °C | |
Use of Eicosapentaenoyl ChlorideEicosapentaenoyl chloride has been used in the synthesis of fatty acid conjugates to enhance lipophilicity and cell permeability of bioactive compounds such as (–)-epigallocatechin gallate and salicylic acid. |
| Name | Eicosapentaenoyl Chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 409.9±34.0 °C at 760 mmHg |
| Molecular Formula | C20H29ClO |
| Molecular Weight | 320.897 |
| Flash Point | 200.5±18.8 °C |
| Exact Mass | 320.190704 |
| LogP | 7.07 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.508 |
| InChIKey | MPMQIVKVFWGFFE-JLNKQSITSA-N |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)Cl |
| 5,8,11,14,17-Eicosapentaenoyl chloride, (5Z,8Z,11Z,14Z,17Z)- |
| (5Z,8Z,11Z,14Z,17Z)-5,8,11,14,17-Icosapentaenoyl chloride |
| Eicosapentaenoyl Chloride |