Eicosapentaenoyl Ethanolamide-d4 structure
|
Common Name | Eicosapentaenoyl Ethanolamide-d4 | ||
|---|---|---|---|---|
| CAS Number | 946524-41-0 | Molecular Weight | 349.543 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 522.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C22H31D4NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 269.8±30.1 °C | |
Use of Eicosapentaenoyl Ethanolamide-d4Eicosapentaenoyl Ethanolamide (EPEA) is an N-acylethanolamide that inhibits dietary-restriction-induced lifespan extension in wild type and TOR pathway mutant nematodes. |
| Name | (5Z,8Z,11Z,14Z,17Z)-N-[2-Hydroxy(2H4)ethyl]-5,8,11,14,17-icosapentaenamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 522.5±50.0 °C at 760 mmHg |
| Molecular Formula | C22H31D4NO2 |
| Molecular Weight | 349.543 |
| Flash Point | 269.8±30.1 °C |
| Exact Mass | 349.291901 |
| PSA | 52.82000 |
| LogP | 4.99 |
| Vapour Pressure | 0.0±3.1 mmHg at 25°C |
| Index of Refraction | 1.514 |
| InChIKey | OVKKNJPJQKTXIT-CFUIKADRSA-N |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)NCCO |
| 5,8,11,14,17-Eicosapentaenamide, N-(2-hydroxyethyl-1,1,2,2-d)-, (5Z,8Z,11Z,14Z,17Z)- |
| (5Z,8Z,11Z,14Z,17Z)-N-[2-Hydroxy(H)ethyl]-5,8,11,14,17-icosapentaenamide |