FEN1-IN-4
Modify Date: 2024-08-09 19:05:38
FEN1-IN-4 structure
|
Common Name | FEN1-IN-4 | ||
|---|---|---|---|---|
| CAS Number | 1995893-58-7 | Molecular Weight | 232.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of FEN1-IN-4FEN1-IN-4 (Compound 2) is a human flap endonuclease-1 (hFEN1) inhibitor[1]. |
| Name | FEN1-IN-4 |
|---|
| Description | FEN1-IN-4 (Compound 2) is a human flap endonuclease-1 (hFEN1) inhibitor[1]. |
|---|---|
| Related Catalog | |
| Target |
hFEN1[1] |
| In Vitro | FEN1 inhibition selectively impairs proliferation of colon cancer cells deficient in Cdc4 and Mre11a, both frequently mutated in colorectal cancers. FEN1 has also emerged as a potential chemosensitizing target due to its role in LP-BER since it is critical for repair of Methyl methanesulfonate-induced alkylation damage, and its knockdown or inhibition increases sensitivity to Temozolomide in glioblastoma and colorectal cancer cell lines[1]. |
| References |
| Molecular Formula | C12H12N2O3 |
|---|---|
| Molecular Weight | 232.24 |
| InChIKey | JAFLWTUYSKADJS-UHFFFAOYSA-N |
| SMILES | O=c1c2ccccc2n(CC2CC2)c(=O)n1O |