Diphenylacetyl chloride structure
|
Common Name | Diphenylacetyl chloride | ||
|---|---|---|---|---|
| CAS Number | 1871-76-7 | Molecular Weight | 230.689 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 304.9±0.0 °C at 760 mmHg | |
| Molecular Formula | C14H11ClO | Melting Point | 49-53 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 154.9±18.0 °C | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 2,2-diphenylacetyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 304.9±0.0 °C at 760 mmHg |
| Melting Point | 49-53 °C(lit.) |
| Molecular Formula | C14H11ClO |
| Molecular Weight | 230.689 |
| Flash Point | 154.9±18.0 °C |
| Exact Mass | 230.049850 |
| PSA | 17.07000 |
| LogP | 3.96 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.584 |
| InChIKey | MSYLETHDEIJMAF-UHFFFAOYSA-N |
| SMILES | O=C(Cl)C(c1ccccc1)c1ccccc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C:Corrosive; |
| Risk Phrases | R34;R36/37 |
| Safety Phrases | S26-S27-S28-S36/37/39-S45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 2 |
| RTECS | AO6750000 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 29163900 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 29163900 |
|---|
|
Selective pivaloylation and diphenylacetylation of cyclomalto-oligosaccharides.
Carbohydr. Res. 262(2) , 271-82, (1994) Regioselective acylation of cyclomalto-oligosaccharides was achieved using pivaloyl and diphenylacetyl chlorides. The reaction of cyclomaltohexaose (1) with pivaloyl chloride gave the hexakis(2,6-di-O... |
|
|
Synthesis and pharmacological screening of certain N-substituted amides structurally related to some local anesthetics.
Pharmazie 34(1) , 12-3, (1979) Diphenylacetyl chloride and pivaloyl chloride have been condensed with a wide variety of amines. Some of the resulting amides showed local anesthetic properties higher than those of procaine hydrochlo... |
| 2,2-di(phenyl)acetyl chloride |
| 2,2-di(phenyl)ethanoyl chloride |
| Diphenylacetyl chloride |
| Diphenylacetic acid chloride |
| EINECS 217-493-5 |
| 2,2-diphenylacetyl chloride |
| α,α-Diphenylacetyl chloride |
| Acetyl chloride,diphenyl |
| 1,1-diphenylacetyl chloride |
| MFCD00013655 |
| Benzeneacetyl chloride, α-phenyl- |
| 2,2-diphenylethanoyl chloride |