Azido Tributyltin structure
|
Common Name | Azido Tributyltin | ||
|---|---|---|---|---|
| CAS Number | 17846-68-3 | Molecular Weight | 332.073 | |
| Density | 1.212 g/mL at 25ºC | Boiling Point | 120ºC/0.2mmHg | |
| Molecular Formula | C12H27N3Sn | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Symbol |
GHS06, GHS08, GHS09 |
Signal Word | Danger | |
| Name | azido(tributyl)stannane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.212 g/mL at 25ºC |
|---|---|
| Boiling Point | 120ºC/0.2mmHg |
| Molecular Formula | C12H27N3Sn |
| Molecular Weight | 332.073 |
| Flash Point | >230 °F |
| Exact Mass | 333.122711 |
| PSA | 49.75000 |
| LogP | 7.75 |
| Index of Refraction | 1.5745 |
| InChIKey | JKVRTUCVPZTEQZ-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](CCCC)(CCCC)N=[N+]=[N-] |
| Water Solubility | Miscible with toluene, hexane, acetonitrile and tetrahydrofuran. |
| Symbol |
GHS06, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H312-H315-H319-H372-H410 |
| Precautionary Statements | Missing Phrase - N15.00950417-P260-P280-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | T: Toxic;N: Dangerous for the environment; |
| Risk Phrases | R21 |
| Safety Phrases | 35-36/37/39-45-60-61 |
| RIDADR | UN 2788 6.1/PG 2 |
| WGK Germany | 3 |
| HS Code | 2931900090 |
|
~%
Azido Tributyltin CAS#:17846-68-3 |
| Literature: US2006/149079 A1, ; Page/Page column 5 ; |
|
~%
Azido Tributyltin CAS#:17846-68-3 |
| Literature: Tr. Khim. Khim. Tekhnol., , p. 23 - 25 |
|
~%
Azido Tributyltin CAS#:17846-68-3 |
| Literature: Sn: Org.Comp.12, 1.4.1.1.1.5.2.1.1, page 38 - 56 |
|
~%
Azido Tributyltin CAS#:17846-68-3 |
| Literature: Sn: Org.Comp.12, 1.4.1.1.1.5.2.1.1, page 38 - 56 |
|
~%
Azido Tributyltin CAS#:17846-68-3 |
| Literature: Sn: Org.Comp.12, 1.4.1.1.1.5.2.1.1, page 38 - 56 |
|
~%
Azido Tributyltin CAS#:17846-68-3 |
| Literature: Sn: Org.Comp.12, 1.4.1.1.1.5.2.1.1, page 38 - 56 |
| Precursor 7 | |
|---|---|
| DownStream 8 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| tri-n-butyltin azide |
| tributylstannanyl azide |
| 3-(Tributylstannyl)triaza-1,2-dien-2-ium-1-ide |
| MFCD00216557 |
| Azidotributyltin(IV) |
| azido-tri-n-butylstannane |
| Azidotributylstannane |
| tri-n-butylstannylazide |
| tributyl tin(IV)-azide |
| TRIBUTYLTIN AZIDE |
| 3-(Tributylstannyl)-1,2-triazadien-2-ium-1-ide |
| Azidotributyltin |
| Azido Tributyltin |
| Stannane, azidotributyl- |
| Tri-n-butylazidotin |