Monensin structure
|
Common Name | Monensin | ||
|---|---|---|---|---|
| CAS Number | 17090-79-8 | Molecular Weight | 670.871 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 766.3±60.0 °C at 760 mmHg | |
| Molecular Formula | C36H61NaO11 | Melting Point | 103-105°C | |
| MSDS | N/A | Flash Point | 229.2±26.4 °C | |
Use of MonensinMonensin is a lipid-soluble naturally occurring bioactive ionophore produced by Streptomyces spp. Monensin can bind protons and monovalent cations. Monensin exhibits a broad spectrum activity against opportunistic pathogens of humans in both drug sensitive and resistant strains. Monensin also induces apoptosis in multiple cancer cell lines[1][2]. |
| Name | monensin A |
|---|---|
| Synonym | More Synonyms |
| Description | Monensin is a lipid-soluble naturally occurring bioactive ionophore produced by Streptomyces spp. Monensin can bind protons and monovalent cations. Monensin exhibits a broad spectrum activity against opportunistic pathogens of humans in both drug sensitive and resistant strains. Monensin also induces apoptosis in multiple cancer cell lines[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 766.3±60.0 °C at 760 mmHg |
| Melting Point | 103-105°C |
| Molecular Formula | C36H61NaO11 |
| Molecular Weight | 670.871 |
| Flash Point | 229.2±26.4 °C |
| Exact Mass | 670.429199 |
| PSA | 156.20000 |
| LogP | 3.72 |
| Vapour Pressure | 0.0±5.9 mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | GAOZTHIDHYLHMS-SJOFMCCUSA-N |
| SMILES | CCC1(C2OC(C3OC(O)(CO)C(C)CC3C)CC2C)CCC(C2(C)CCC3(CC(O)C(C)C(C(C)C(OC)C(C)C(=O)O)O3)O2)O1 |
| Storage condition | 2-8°C |
| Hazard Codes | T: Toxic; |
|---|---|
| Risk Phrases | R25 |
| Safety Phrases | S36/37/39-S45 |
| RIDADR | UN 3462 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | JH2830000 |
| Packaging Group | II |
| Hazard Class | 6.1(a) |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| 1,6-Dioxaspiro[4.5]decane-7-butanoic acid, 2-[(2S,2'R,3'S,5R,5'R)-2-ethyloctahydro-3'-methyl-5'-[(2S,3S,5R,6R)-tetrahydro-6-hydroxy-6-(hydroxymethyl)-3,5-dimethyl-2H-pyran-2-yl][2,2'-bifuran]-5-yl]-9- ;hydroxy-β-methoxy-α,γ,2,8-tetramethyl-, (αS,βR,γS,2S,5R,7S,8R,9S)- |
| monensicacid |
| Monensin |
| Elancoban |
| Monelan |
| Romensin |
| MONENSIN SODIUM |
| 1,6-dioxaspiro[4.5]decane-7-butanoic acid, 2-[(2S,2'R,3'S,5R,5'R)-2-ethyloctahydro-3'-methyl-5'-[(2S,3S,5R,6R)-tetrahydro-6-hydroxy-6-(hydroxymethyl)-3,5-dimethyl-2H-pyran-2-yl][2,2'-bifuran]-5-yl]-9-hydroxy-b-methoxy-a,g,2,8-tetramethyl-, (aS,bR,gS,2S,5R,7S,8R,9S)- |
| MONENSIN(PURE) |
| MFCD00077826 |
| EINECS 244-941-7 |
| a3823a |
| 1,6-dioxaspiro[4.5]decane-7-butanoic acid, 2-[(2S,2'R,3'S,5R,5'R)-2-ethyloctahydro-3'-methyl-5'-[(2S,3S,5R,6R)-tetrahydro-6-hydroxy-6-(hydroxymethyl)-3,5-dimethyl-2H-pyran-2-yl][2,2'-bifuran]-5-yl]-9-hydroxy-β-methoxy-α,γ,2,8-tetramethyl-, (αS,βR,γS,2S,5R,7S,8R,9S)- |
| (2S,3R,4S)-4-[(2S,5R,7S,8R,9S)-2-{(2S,2'R,3'S,5R,5'R)-2-Ethyl-5'-[(2S,3S,5R,6R)-6-hydroxy-6-(hydroxymethyl)-3,5-dimethyltetrahydro-2H-pyran-2-yl]-3'-methyloctahydro-2,2'-bifuran-5-yl}-9-hydroxy-2,8-dimethyl-1,6-dioxaspiro[4.5]dec-7-yl]-3-methoxy-2-methylpentanoic acid |
| MONENSIN NA |