Monensin B structure
|
Common Name | Monensin B | ||
|---|---|---|---|---|
| CAS Number | 30485-16-6 | Molecular Weight | 656.84400 | |
| Density | 1.22g/cm3 | Boiling Point | 760.1ºC at 760mmHg | |
| Molecular Formula | C35H60O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.2ºC | |
Use of Monensin BMonensin B is a polyketide produced by Streptomyces cinnamonensis. Fermentations of Streptomyces cinnamonensis produce a mixture of Monensin A and Monensin B in a ratio dependent upon the relative concentrations of ethylmalonyl-CoA and methylmalonyl-CoA[1]. |
| Name | 4-[9-hydroxy-3-[5-[5-[6-hydroxy-6-(hydroxymethyl)-3,5-dimethyloxan-2-yl]-3-methyloxolan-2-yl]-5-methyloxolan-2-yl]-3,8-dimethyl-1,6-dioxaspiro[4.5]decan-7-yl]-3-methoxy-2-methylpentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Monensin B is a polyketide produced by Streptomyces cinnamonensis. Fermentations of Streptomyces cinnamonensis produce a mixture of Monensin A and Monensin B in a ratio dependent upon the relative concentrations of ethylmalonyl-CoA and methylmalonyl-CoA[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 760.1ºC at 760mmHg |
| Molecular Formula | C35H60O11 |
| Molecular Weight | 656.84400 |
| Flash Point | 229.2ºC |
| Exact Mass | 656.41400 |
| PSA | 153.37000 |
| LogP | 3.74030 |
| Index of Refraction | 1.547 |
| InChIKey | ZXLUKLZKZXJEFX-FXZRHDQVSA-N |
| SMILES | COC(C(C)C(=O)O)C(C)C1OC2(CCC(C)(C3CCC(C)(C4OC(C5OC(O)(CO)C(C)CC5C)CC4C)O3)O2)CC(O)C1C |
| Monensin,16-deethyl-16-methyl |
| Monensin B |
| 16-Deethyl-16-methylmonensin |