2",4"-Di-O-(E-p-coumaroyl)afzelin
Modify Date: 2025-08-27 02:04:43
2",4"-Di-O-(E-p-coumaroyl)afzelin structure
|
Common Name | 2",4"-Di-O-(E-p-coumaroyl)afzelin | ||
|---|---|---|---|---|
| CAS Number | 163434-73-9 | Molecular Weight | 724.66 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 966.9±65.0 °C at 760 mmHg | |
| Molecular Formula | C39H32O14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 302.1±27.8 °C | |
Use of 2",4"-Di-O-(E-p-coumaroyl)afzelin2'',4''-Di-O-(E-p-Coumaroyl)afzelin (compound 36) is a compound isolated from Epimedium sagittatum[1]. |
| Name | 2",4"-Di-O-(E-p-coumaroyl)afzelin |
|---|---|
| Synonym | More Synonyms |
| Description | 2'',4''-Di-O-(E-p-Coumaroyl)afzelin (compound 36) is a compound isolated from Epimedium sagittatum[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 966.9±65.0 °C at 760 mmHg |
| Molecular Formula | C39H32O14 |
| Molecular Weight | 724.66 |
| Flash Point | 302.1±27.8 °C |
| Exact Mass | 724.179199 |
| PSA | 222.65000 |
| LogP | 6.26 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.737 |
| InChIKey | KMOHJUXDKSMQOG-NCLAQALISA-N |
| SMILES | CC1OC(Oc2c(-c3ccc(O)cc3)oc3cc(O)cc(O)c3c2=O)C(OC(=O)C=Cc2ccc(O)cc2)C(O)C1OC(=O)C=Cc1ccc(O)cc1 |
| Hazard Codes | Xi |
|---|
| 5,7-Dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-3-yl 6-deoxy-2,4-bis-O-[(2E)-3-(4-hydroxyphenyl)-2-propenoyl]-α-L-mannopyranoside |
| 4H-1-Benzopyran-4-one, 3-[[6-deoxy-2,4-bis-O-[(2E)-3-(4-hydroxyphenyl)-1-oxo-2-propen-1-yl]-α-L-mannopyranosyl]oxy]-5,7-dihydroxy-2-(4-hydroxyphenyl)- |