3",4"-Di-O-acetyl-2",6"-di-O-p-couMaroylastragalin structure
|
Common Name | 3",4"-Di-O-acetyl-2",6"-di-O-p-couMaroylastragalin | ||
|---|---|---|---|---|
| CAS Number | 349545-02-4 | Molecular Weight | 824.73600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C43H36O17 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 3",4"-Di-O-acetyl-2",6"-di-O-p-couMaroylastragalinKaempferol 3-O-(2'',4''-di-acetyl-3''-cis-p-coumaroyl-6''-trans-p-coumaroyl)-β-D-glucopyranoside is a flavonoid compound that can be isolated from Quercus dentata. Kaempferol 3-O-(2'',4''-di-acetyl-3''-cis-p-coumaroyl-6''-trans-p-coumaroyl)-β-D-glucopyranoside suppresses the superoxide generation induced by arachidonic acid[1]. |
| Name | (2R,3R,4S,5R,6S)-6-((5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-3-yl)oxy)-5-(((Z)-3-(4-hydroxyphenyl)acryloyl)oxy)-2-((((E)-3-(4-hydroxyphenyl)acryloyl)oxy)methyl)tetrahydro-2H-pyran-3,4-diyl diacetate |
|---|
| Description | Kaempferol 3-O-(2'',4''-di-acetyl-3''-cis-p-coumaroyl-6''-trans-p-coumaroyl)-β-D-glucopyranoside is a flavonoid compound that can be isolated from Quercus dentata. Kaempferol 3-O-(2'',4''-di-acetyl-3''-cis-p-coumaroyl-6''-trans-p-coumaroyl)-β-D-glucopyranoside suppresses the superoxide generation induced by arachidonic acid[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C43H36O17 |
|---|---|
| Molecular Weight | 824.73600 |
| Exact Mass | 824.19500 |
| PSA | 255.02000 |
| LogP | 4.83690 |
| InChIKey | IFLHDGGEJKVLAF-ASZZAFOJSA-N |
| SMILES | CC(=O)OC1C(COC(=O)C=Cc2ccc(O)cc2)OC(Oc2c(-c3ccc(O)cc3)oc3cc(O)cc(O)c3c2=O)C(OC(=O)C=Cc2ccc(O)cc2)C1OC(C)=O |
| Hazard Codes | Xi |
|---|