3",4"-Di-O-acetyl-2",6"-di-O-p-couMaroylastragalin
Modify Date: 2025-08-26 18:21:29
3",4"-Di-O-acetyl-2",6"-di-O-p-couMaroylastragalin structure
|
Common Name | 3",4"-Di-O-acetyl-2",6"-di-O-p-couMaroylastragalin | ||
|---|---|---|---|---|
| CAS Number | 137018-33-8 | Molecular Weight | 824.736 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 995.3±65.0 °C at 760 mmHg | |
| Molecular Formula | C43H36O17 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 301.1±27.8 °C | |
Use of 3",4"-Di-O-acetyl-2",6"-di-O-p-couMaroylastragalin3'',4''-Di-O-acetyl-2'',6''-di-O-p-coumaroylastragalin is a flavonoid that can be isolated from Quercus ilex[1]. |
| Name | (2R,3R,4S,5R,6S)-6-((5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-3-yl)oxy)-5-(((E)-3-(4-hydroxyphenyl)acryloyl)oxy)-2-((((E)-3-(4-hydroxyphenyl)acryloyl)oxy)methyl)tetrahydro-2H-pyran-3,4-diyl diacetate |
|---|---|
| Synonym | More Synonyms |
| Description | 3'',4''-Di-O-acetyl-2'',6''-di-O-p-coumaroylastragalin is a flavonoid that can be isolated from Quercus ilex[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 995.3±65.0 °C at 760 mmHg |
| Molecular Formula | C43H36O17 |
| Molecular Weight | 824.736 |
| Flash Point | 301.1±27.8 °C |
| Exact Mass | 824.195251 |
| PSA | 255.02000 |
| LogP | 7.04 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.700 |
| InChIKey | IFLHDGGEJKVLAF-FEMPFSAESA-N |
| SMILES | CC(=O)OC1C(COC(=O)C=Cc2ccc(O)cc2)OC(Oc2c(-c3ccc(O)cc3)oc3cc(O)cc(O)c3c2=O)C(OC(=O)C=Cc2ccc(O)cc2)C1OC(C)=O |
| Hazard Codes | Xi |
|---|
| 5,7-Dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-3-yl 3,4-di-O-acetyl-2,6-bis-O-[(2E)-3-(4-hydroxyphenyl)-2-propenoyl]-β-D-glucopyranoside |
| 4H-1-Benzopyran-4-one, 3-[[3,4-di-O-acetyl-2,6-bis-O-[(2E)-3-(4-hydroxyphenyl)-1-oxo-2-propen-1-yl]-β-D-glucopyranosyl]oxy]-5,7-dihydroxy-2-(4-hydroxyphenyl)- |