MC-Gly-Gly-Phe-Boc
Modify Date: 2025-09-13 12:08:52
MC-Gly-Gly-Phe-Boc structure
|
Common Name | MC-Gly-Gly-Phe-Boc | ||
|---|---|---|---|---|
| CAS Number | 1599440-14-8 | Molecular Weight | 528.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H36N4O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MC-Gly-Gly-Phe-BocMC-Gly-Gly-Phe-Boc is involved in the synthesis of Antibody-Drug Conjugates (ADCs) to Trastuzumab (HY-P9907). MC-Gly-Gly-Phe-Boc can participate in cancer research[1]. |
| Name | L-Phenylalanine, N-[6-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-1-oxohexyl]glycylglycyl-, 1,1-dimethylethyl ester |
|---|
| Description | MC-Gly-Gly-Phe-Boc is involved in the synthesis of Antibody-Drug Conjugates (ADCs) to Trastuzumab (HY-P9907). MC-Gly-Gly-Phe-Boc can participate in cancer research[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C27H36N4O7 |
|---|---|
| Molecular Weight | 528.6 |
| InChIKey | WYEZMAYVPSHIHY-FQEVSTJZSA-N |
| SMILES | CC(C)(C)OC(=O)C(Cc1ccccc1)NC(=O)CNC(=O)CNC(=O)CCCCCN1C(=O)C=CC1=O |