MK 386
Modify Date: 2025-08-28 08:17:56
MK 386 structure
|
Common Name | MK 386 | ||
|---|---|---|---|---|
| CAS Number | 158493-17-5 | Molecular Weight | 415.69 | |
| Density | 0.951g/cm3 | Boiling Point | 505.2ºC at 760mmHg | |
| Molecular Formula | C28H49NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.9ºC | |
Use of MK 386MK 386 (L-733692) is a selective 5-α-reductase I inhibitor, used for prostate cancer inhibition[1]. |
| Name | 4,6,9a,11a-tetramethyl-1-(6-methylheptan-2-yl)-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one |
|---|
| Description | MK 386 (L-733692) is a selective 5-α-reductase I inhibitor, used for prostate cancer inhibition[1]. |
|---|---|
| Related Catalog | |
| Target |
5-α-reductase I[1] |
| References |
| Density | 0.951g/cm3 |
|---|---|
| Boiling Point | 505.2ºC at 760mmHg |
| Molecular Formula | C28H49NO |
| Molecular Weight | 415.69 |
| Flash Point | 203.9ºC |
| Exact Mass | 415.38100 |
| PSA | 20.31000 |
| LogP | 7.11230 |
| Vapour Pressure | 2.48E-10mmHg at 25°C |
| Index of Refraction | 1.494 |
| InChIKey | XUTZDXHKQDPUMA-MVJJLJOTSA-N |
| SMILES | CC(C)CCCC(C)C1CCC2C3C(C)CC4N(C)C(=O)CCC4(C)C3CCC12C |