G244-LM structure
|
Common Name | G244-LM | ||
|---|---|---|---|---|
| CAS Number | 1563007-08-8 | Molecular Weight | 406.522 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H22N4O3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of G244-LMG244-LM is a potent and specific inhibitor of tankyrase 1/2 that inhibits Wnt signaling[1]. |
| Name | 2-{4-[2-(Methylsulfonyl)phenyl]-1-piperazinyl}-3,5,7,8-tetrahydro-4H-thiopyrano[4,3-d]pyrimidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | G244-LM is a potent and specific inhibitor of tankyrase 1/2 that inhibits Wnt signaling[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Molecular Formula | C18H22N4O3S2 |
| Molecular Weight | 406.522 |
| Exact Mass | 406.113342 |
| LogP | 0.04 |
| Index of Refraction | 1.727 |
| InChIKey | JSQPAEVPPSCQMV-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1ccccc1N1CCN(c2nc3c(c(=O)[nH]2)CSCC3)CC1 |
| Hazard Codes | Xi |
|---|
| 2-{4-[2-(Methylsulfonyl)phenyl]-1-piperazinyl}-3,5,7,8-tetrahydro-4H-thiopyrano[4,3-d]pyrimidin-4-one |
| 4H-Thiopyrano[4,3-d]pyrimidin-4-one, 3,5,7,8-tetrahydro-2-[4-[2-(methylsulfonyl)phenyl]-1-piperazinyl]- |
| G244-LM |