Triphenyl Ethoxysilane structure
|
Common Name | Triphenyl Ethoxysilane | ||
|---|---|---|---|---|
| CAS Number | 1516-80-9 | Molecular Weight | 304.458 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 344.0±11.0 °C at 760 mmHg | |
| Molecular Formula | C20H20OSi | Melting Point | 64ºC | |
| MSDS | N/A | Flash Point | 163.5±9.5 °C | |
| Name | ethoxy(triphenyl)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 344.0±11.0 °C at 760 mmHg |
| Melting Point | 64ºC |
| Molecular Formula | C20H20OSi |
| Molecular Weight | 304.458 |
| Flash Point | 163.5±9.5 °C |
| Exact Mass | 304.128326 |
| PSA | 9.23000 |
| LogP | 7.41 |
| Appearance of Characters | solid |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | ZVJXKUWNRVOUTI-UHFFFAOYSA-N |
| SMILES | CCO[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| Storage condition | 2~8 ℃ |
| Precursor 9 | |
|---|---|
| DownStream 9 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Silane, ethoxytriphenyl- |
| Ethoxy(triphenyl)silane |
| Silane,ethoxytriphenyl |
| ethoxytriphenylsilane |
| Aethoxy-triphenyl-silan |
| Benzene, 1,1',1''-(ethoxysilylidyne)tris- |
| Ethyl triphenylsilyl ether |
| triphenylethoxysilane |
| Triphenyl Ethoxysilane |