Chlorotriphenylsilane structure
|
Common Name | Chlorotriphenylsilane | ||
|---|---|---|---|---|
| CAS Number | 76-86-8 | Molecular Weight | 294.850 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 374.8±15.0 °C at 760 mmHg | |
| Molecular Formula | C18H15ClSi | Melting Point | 91-94 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 164.5±10.3 °C | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | Chlorotriphenylsilane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 374.8±15.0 °C at 760 mmHg |
| Melting Point | 91-94 °C(lit.) |
| Molecular Formula | C18H15ClSi |
| Molecular Weight | 294.850 |
| Flash Point | 164.5±10.3 °C |
| Exact Mass | 294.063141 |
| LogP | 7.43 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | MNKYQPOFRKPUAE-UHFFFAOYSA-N |
| SMILES | Cl[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| Water Solubility | acetone: 0.1 g/mL, clear |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C:Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45-S24/25 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 1 |
| RTECS | VV2720000 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 29310095 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 29310095 |
|---|
|
[Preparation of phenyl treated packing materials for high-performance liquid chromatography: evaluation by retention behaviour of carbamazepine and diphenylhydantoin].
Yakugaku Zasshi 112(6) , 409-13, (1992) The retention behavior and selectivity of 30 kinds of phenyl-modified porous glasses and silicas, prepared from solutions of phenyldimethylchlorosilane, diphenylmethylchlorosilane or triphenylchlorosi... |
| Benzene, 1,1',1''-(chlorosilylidyne)tris- |
| Triphenylsilyl chloride |
| Chloro(triphenyl)silane |
| Chlorotriphenylsilane |
| triphenylsilylchloride |
| Triphenylchlorosilane |
| EINECS 200-989-0 |
| MFCD00000496 |